C10H13Cl2F3N4O2 — CID 18526045
2-aminooxy-N-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]acetamide;hydrochloride (PubChem CID 18526045) has the molecular formula C10H13Cl2F3N4O2 and a molecular weight of 349.14 g/mol. Its IUPAC name is 2-aminooxy-N-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]acetamide;hydrochloride.
| Compound Name | 2-aminooxy-N-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 18526045 |
| Molecular Formula | C10H13Cl2F3N4O2 |
| Molecular Weight | 349.14 g/mol |
| Exact Mass | 348.04 |
| IUPAC Name | 2-aminooxy-N-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]acetamide;hydrochloride |
| SMILES | Cl.NOCC(=O)NCCNc1ncc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C10H12ClF3N4O2.ClH/c11-7-3-6(10(12,13)14)4-18-9(7)17-2-1-16-8(19)5-20-15;/h3-4H,1-2,5,15H2,(H,16,19)(H,17,18);1H |
| InChIKey | KXDLJTBLZSHEQP-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.14 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|