C18H17ClF3N3O3 — CID 26373641
N-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-2-(2,3-dihydro-1,4-benzodioxin-6-yl)acetamide (PubChem CID 26373641) has the molecular formula C18H17ClF3N3O3 and a molecular weight of 415.80 g/mol. Its IUPAC name is N-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-2-(2,3-dihydro-1,4-benzodioxin-6-yl)acetamide.
| Compound Name | N-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-2-(2,3-dihydro-1,4-benzodioxin-6-yl)acetamide |
|---|---|
| PubChem CID | 26373641 |
| Molecular Formula | C18H17ClF3N3O3 |
| Molecular Weight | 415.80 g/mol |
| Exact Mass | 415.09 |
| IUPAC Name | N-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-2-(2,3-dihydro-1,4-benzodioxin-6-yl)acetamide |
| SMILES | O=C(Cc1ccc2c(c1)OCCO2)NCCNc1ncc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C18H17ClF3N3O3/c19-13-9-12(18(20,21)22)10-25-17(13)24-4-3-23-16(26)8-11-1-2-14-15(7-11)28-6-5-27-14/h1-2,7,9-10H,3-6,8H2,(H,23,26)(H,24,25) |
| InChIKey | ZANPXUOUTTXJMS-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.80 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|