C18H16ClF3N2O3S — CID 18279491
3-(1,3-benzodioxol-5-yl)-N-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]sulfanyl]ethyl]propanamide (PubChem CID 18279491) has the molecular formula C18H16ClF3N2O3S and a molecular weight of 432.85 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-N-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]sulfanyl]ethyl]propanamide.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-N-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]sulfanyl]ethyl]propanamide |
|---|---|
| PubChem CID | 18279491 |
| Molecular Formula | C18H16ClF3N2O3S |
| Molecular Weight | 432.85 g/mol |
| Exact Mass | 432.05 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-N-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]sulfanyl]ethyl]propanamide |
| SMILES | O=C(CCc1ccc2c(c1)OCO2)NCCSc1ncc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C18H16ClF3N2O3S/c19-13-8-12(18(20,21)22)9-24-17(13)28-6-5-23-16(25)4-2-11-1-3-14-15(7-11)27-10-26-14/h1,3,7-9H,2,4-6,10H2,(H,23,25) |
| InChIKey | CZBUQAZIDHWNPA-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.85 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|