C13H8Cl3F3N2OS2 — CID 24516606
2,5-dichloro-N-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]sulfanyl]ethyl]thiophene-3-carboxamide (PubChem CID 24516606) has the molecular formula C13H8Cl3F3N2OS2 and a molecular weight of 435.71 g/mol. Its IUPAC name is 2,5-dichloro-N-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]sulfanyl]ethyl]thiophene-3-carboxamide.
| Compound Name | 2,5-dichloro-N-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]sulfanyl]ethyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 24516606 |
| Molecular Formula | C13H8Cl3F3N2OS2 |
| Molecular Weight | 435.71 g/mol |
| Exact Mass | 433.91 |
| IUPAC Name | 2,5-dichloro-N-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]sulfanyl]ethyl]thiophene-3-carboxamide |
| SMILES | O=C(NCCSc1ncc(C(F)(F)F)cc1Cl)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C13H8Cl3F3N2OS2/c14-8-3-6(13(17,18)19)5-21-12(8)23-2-1-20-11(22)7-4-9(15)24-10(7)16/h3-5H,1-2H2,(H,20,22) |
| InChIKey | AAVMZNDBASOAOI-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.71 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|