C18H18ClF3N2O2S — CID 16579332
N-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]sulfanyl]ethyl]-2-(3-methylphenoxy)propanamide (PubChem CID 16579332) has the molecular formula C18H18ClF3N2O2S and a molecular weight of 418.87 g/mol. Its IUPAC name is N-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]sulfanyl]ethyl]-2-(3-methylphenoxy)propanamide.
| Compound Name | N-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]sulfanyl]ethyl]-2-(3-methylphenoxy)propanamide |
|---|---|
| PubChem CID | 16579332 |
| Molecular Formula | C18H18ClF3N2O2S |
| Molecular Weight | 418.87 g/mol |
| Exact Mass | 418.07 |
| IUPAC Name | N-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]sulfanyl]ethyl]-2-(3-methylphenoxy)propanamide |
| SMILES | Cc1cccc(OC(C)C(=O)NCCSc2ncc(C(F)(F)F)cc2Cl)c1 |
| InChI | InChI=1S/C18H18ClF3N2O2S/c1-11-4-3-5-14(8-11)26-12(2)16(25)23-6-7-27-17-15(19)9-13(10-24-17)18(20,21)22/h3-5,8-10,12H,6-7H2,1-2H3,(H,23,25) |
| InChIKey | KNUROLYWSJVJJD-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.87 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|