C18H14ClF3N4O2S — CID 4851947
N-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]sulfanyl]ethyl]-3-methyl-4-oxophthalazine-1-carboxamide (PubChem CID 4851947) has the molecular formula C18H14ClF3N4O2S and a molecular weight of 442.85 g/mol. Its IUPAC name is N-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]sulfanyl]ethyl]-3-methyl-4-oxophthalazine-1-carboxamide.
| Compound Name | N-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]sulfanyl]ethyl]-3-methyl-4-oxophthalazine-1-carboxamide |
|---|---|
| PubChem CID | 4851947 |
| Molecular Formula | C18H14ClF3N4O2S |
| Molecular Weight | 442.85 g/mol |
| Exact Mass | 442.05 |
| IUPAC Name | N-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]sulfanyl]ethyl]-3-methyl-4-oxophthalazine-1-carboxamide |
| SMILES | Cn1nc(C(=O)NCCSc2ncc(C(F)(F)F)cc2Cl)c2ccccc2c1=O |
| InChI | InChI=1S/C18H14ClF3N4O2S/c1-26-17(28)12-5-3-2-4-11(12)14(25-26)15(27)23-6-7-29-16-13(19)8-10(9-24-16)18(20,21)22/h2-5,8-9H,6-7H2,1H3,(H,23,27) |
| InChIKey | BPPUKGZFIGHAEV-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.85 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|