C18H16Cl2F3N3O4S — CID 24603721
4-(2-amino-2-oxoethoxy)-3-chloro-N-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]sulfanyl]ethyl]-5-methoxybenzamide (PubChem CID 24603721) has the molecular formula C18H16Cl2F3N3O4S and a molecular weight of 498.31 g/mol. Its IUPAC name is 4-(2-amino-2-oxoethoxy)-3-chloro-N-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]sulfanyl]ethyl]-5-methoxybenzamide.
| Compound Name | 4-(2-amino-2-oxoethoxy)-3-chloro-N-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]sulfanyl]ethyl]-5-methoxybenzamide |
|---|---|
| PubChem CID | 24603721 |
| Molecular Formula | C18H16Cl2F3N3O4S |
| Molecular Weight | 498.31 g/mol |
| Exact Mass | 497.02 |
| IUPAC Name | 4-(2-amino-2-oxoethoxy)-3-chloro-N-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]sulfanyl]ethyl]-5-methoxybenzamide |
| SMILES | COc1cc(C(=O)NCCSc2ncc(C(F)(F)F)cc2Cl)cc(Cl)c1OCC(N)=O |
| InChI | InChI=1S/C18H16Cl2F3N3O4S/c1-29-13-5-9(4-11(19)15(13)30-8-14(24)27)16(28)25-2-3-31-17-12(20)6-10(7-26-17)18(21,22)23/h4-7H,2-3,8H2,1H3,(H2,24,27)(H,25,28) |
| InChIKey | FHNQWSHKKSOBBL-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 103.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.31 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|