C17H12F3N3O2 — CID 18075195
3-methyl-4-oxo-N-[2-(trifluoromethyl)phenyl]phthalazine-1-carboxamide (PubChem CID 18075195) has the molecular formula C17H12F3N3O2 and a molecular weight of 347.30 g/mol. Its IUPAC name is 3-methyl-4-oxo-N-[2-(trifluoromethyl)phenyl]phthalazine-1-carboxamide.
| Compound Name | 3-methyl-4-oxo-N-[2-(trifluoromethyl)phenyl]phthalazine-1-carboxamide |
|---|---|
| PubChem CID | 18075195 |
| Molecular Formula | C17H12F3N3O2 |
| Molecular Weight | 347.30 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | 3-methyl-4-oxo-N-[2-(trifluoromethyl)phenyl]phthalazine-1-carboxamide |
| SMILES | Cn1nc(C(=O)Nc2ccccc2C(F)(F)F)c2ccccc2c1=O |
| InChI | InChI=1S/C17H12F3N3O2/c1-23-16(25)11-7-3-2-6-10(11)14(22-23)15(24)21-13-9-5-4-8-12(13)17(18,19)20/h2-9H,1H3,(H,21,24) |
| InChIKey | JDMVZYDYYFYDPL-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.30 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |