C16H11ClFN3O2 — CID 4810793
N-(2-chloro-4-fluorophenyl)-3-methyl-4-oxophthalazine-1-carboxamide (PubChem CID 4810793) has the molecular formula C16H11ClFN3O2 and a molecular weight of 331.73 g/mol. Its IUPAC name is N-(2-chloro-4-fluorophenyl)-3-methyl-4-oxophthalazine-1-carboxamide.
| Compound Name | N-(2-chloro-4-fluorophenyl)-3-methyl-4-oxophthalazine-1-carboxamide |
|---|---|
| PubChem CID | 4810793 |
| Molecular Formula | C16H11ClFN3O2 |
| Molecular Weight | 331.73 g/mol |
| Exact Mass | 331.05 |
| IUPAC Name | N-(2-chloro-4-fluorophenyl)-3-methyl-4-oxophthalazine-1-carboxamide |
| SMILES | Cn1nc(C(=O)Nc2ccc(F)cc2Cl)c2ccccc2c1=O |
| InChI | InChI=1S/C16H11ClFN3O2/c1-21-16(23)11-5-3-2-4-10(11)14(20-21)15(22)19-13-7-6-9(18)8-12(13)17/h2-8H,1H3,(H,19,22) |
| InChIKey | AAIDMQKYCDBWTR-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.73 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |