C13H18ClF3N2S — CID 62578481
N-[3-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]sulfanyl]propyl]-2-methylpropan-1-amine (PubChem CID 62578481) has the molecular formula C13H18ClF3N2S and a molecular weight of 326.82 g/mol. Its IUPAC name is N-[3-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]sulfanyl]propyl]-2-methylpropan-1-amine.
| Compound Name | N-[3-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]sulfanyl]propyl]-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 62578481 |
| Molecular Formula | C13H18ClF3N2S |
| Molecular Weight | 326.82 g/mol |
| Exact Mass | 326.08 |
| IUPAC Name | N-[3-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]sulfanyl]propyl]-2-methylpropan-1-amine |
| SMILES | CC(C)CNCCCSc1ncc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C13H18ClF3N2S/c1-9(2)7-18-4-3-5-20-12-11(14)6-10(8-19-12)13(15,16)17/h6,8-9,18H,3-5,7H2,1-2H3 |
| InChIKey | UHXVFYAPAQDMBR-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.82 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|