C14H20ClF3N2S — CID 63515474
N-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]sulfanyl]ethyl]hexan-1-amine (PubChem CID 63515474) has the molecular formula C14H20ClF3N2S and a molecular weight of 340.84 g/mol. Its IUPAC name is N-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]sulfanyl]ethyl]hexan-1-amine.
| Compound Name | N-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]sulfanyl]ethyl]hexan-1-amine |
|---|---|
| PubChem CID | 63515474 |
| Molecular Formula | C14H20ClF3N2S |
| Molecular Weight | 340.84 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | N-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]sulfanyl]ethyl]hexan-1-amine |
| SMILES | CCCCCCNCCSc1ncc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C14H20ClF3N2S/c1-2-3-4-5-6-19-7-8-21-13-12(15)9-11(10-20-13)14(16,17)18/h9-10,19H,2-8H2,1H3 |
| InChIKey | BZOUUERBMUCIMQ-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.84 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|