C10H11ClF3NOS — CID 86777244
1-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]sulfanyl]-2-methylpropan-2-ol (PubChem CID 86777244) has the molecular formula C10H11ClF3NOS and a molecular weight of 285.72 g/mol. Its IUPAC name is 1-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]sulfanyl]-2-methylpropan-2-ol.
| Compound Name | 1-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]sulfanyl]-2-methylpropan-2-ol |
|---|---|
| PubChem CID | 86777244 |
| Molecular Formula | C10H11ClF3NOS |
| Molecular Weight | 285.72 g/mol |
| Exact Mass | 285.02 |
| IUPAC Name | 1-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]sulfanyl]-2-methylpropan-2-ol |
| SMILES | CC(C)(O)CSc1ncc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C10H11ClF3NOS/c1-9(2,16)5-17-8-7(11)3-6(4-15-8)10(12,13)14/h3-4,16H,5H2,1-2H3 |
| InChIKey | AZKVYCFONMJHTG-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.72 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |