C10H7Cl3F3NS — CID 1473940
3-chloro-2-[[(1S)-2,2-dichlorocyclopropyl]methylsulfanyl]-5-(trifluoromethyl)pyridine (PubChem CID 1473940) has the molecular formula C10H7Cl3F3NS and a molecular weight of 336.59 g/mol. Its IUPAC name is 3-chloro-2-[[(1S)-2,2-dichlorocyclopropyl]methylsulfanyl]-5-(trifluoromethyl)pyridine.
| Compound Name | 3-chloro-2-[[(1S)-2,2-dichlorocyclopropyl]methylsulfanyl]-5-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 1473940 |
| Molecular Formula | C10H7Cl3F3NS |
| Molecular Weight | 336.59 g/mol |
| Exact Mass | 334.93 |
| IUPAC Name | 3-chloro-2-[[(1S)-2,2-dichlorocyclopropyl]methylsulfanyl]-5-(trifluoromethyl)pyridine |
| SMILES | FC(F)(F)c1cnc(SC[C@@H]2CC2(Cl)Cl)c(Cl)c1 |
| InChI | InChI=1S/C10H7Cl3F3NS/c11-7-1-5(10(14,15)16)3-17-8(7)18-4-6-2-9(6,12)13/h1,3,6H,2,4H2/t6-/m0/s1 |
| InChIKey | GMSPZAKAUZKINW-LURJTMIESA-N |
| XLogP | 5.04 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.59 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|