C13H8Cl2F3NS — CID 2744942
3-chloro-2-[(4-chlorophenyl)methylsulfanyl]-5-(trifluoromethyl)pyridine (PubChem CID 2744942) has the molecular formula C13H8Cl2F3NS and a molecular weight of 338.18 g/mol. Its IUPAC name is 3-chloro-2-[(4-chlorophenyl)methylsulfanyl]-5-(trifluoromethyl)pyridine.
| Compound Name | 3-chloro-2-[(4-chlorophenyl)methylsulfanyl]-5-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 2744942 |
| Molecular Formula | C13H8Cl2F3NS |
| Molecular Weight | 338.18 g/mol |
| Exact Mass | 336.97 |
| IUPAC Name | 3-chloro-2-[(4-chlorophenyl)methylsulfanyl]-5-(trifluoromethyl)pyridine |
| SMILES | FC(F)(F)c1cnc(SCc2ccc(Cl)cc2)c(Cl)c1 |
| InChI | InChI=1S/C13H8Cl2F3NS/c14-10-3-1-8(2-4-10)7-20-12-11(15)5-9(6-19-12)13(16,17)18/h1-6H,7H2 |
| InChIKey | HSHVRDAJJLJVAA-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.18 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |