C8H8Cl2F3N3S — CID 138111368
2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]sulfanyl]ethanimidamide;hydrochloride (PubChem CID 138111368) has the molecular formula C8H8Cl2F3N3S and a molecular weight of 306.14 g/mol. Its IUPAC name is 2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]sulfanyl]ethanimidamide;hydrochloride.
| Compound Name | 2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]sulfanyl]ethanimidamide;hydrochloride |
|---|---|
| PubChem CID | 138111368 |
| Molecular Formula | C8H8Cl2F3N3S |
| Molecular Weight | 306.14 g/mol |
| Exact Mass | 304.98 |
| IUPAC Name | 2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]sulfanyl]ethanimidamide;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)CSc1ncc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C8H7ClF3N3S.ClH/c9-5-1-4(8(10,11)12)2-15-7(5)16-3-6(13)14;/h1-2H,3H2,(H3,13,14);1H |
| InChIKey | SZXLJHRNAWAXGO-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 62.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.14 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|