C8H9Cl2F3N2S — CID 43810441
2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]sulfanyl]ethanamine;hydrochloride (PubChem CID 43810441) has the molecular formula C8H9Cl2F3N2S and a molecular weight of 293.14 g/mol. Its IUPAC name is 2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]sulfanyl]ethanamine;hydrochloride.
| Compound Name | 2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]sulfanyl]ethanamine;hydrochloride |
|---|---|
| PubChem CID | 43810441 |
| Molecular Formula | C8H9Cl2F3N2S |
| Molecular Weight | 293.14 g/mol |
| Exact Mass | 291.98 |
| IUPAC Name | 2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]sulfanyl]ethanamine;hydrochloride |
| SMILES | Cl.NCCSc1ncc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C8H8ClF3N2S.ClH/c9-6-3-5(8(10,11)12)4-14-7(6)15-2-1-13;/h3-4H,1-2,13H2;1H |
| InChIKey | UDYJQMDCWQLTBQ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.14 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |