C12H6ClF5N2S — CID 61371607
4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]sulfanyl]-3,5-difluoroaniline (PubChem CID 61371607) has the molecular formula C12H6ClF5N2S and a molecular weight of 340.70 g/mol. Its IUPAC name is 4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]sulfanyl]-3,5-difluoroaniline.
| Compound Name | 4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]sulfanyl]-3,5-difluoroaniline |
|---|---|
| PubChem CID | 61371607 |
| Molecular Formula | C12H6ClF5N2S |
| Molecular Weight | 340.70 g/mol |
| Exact Mass | 339.99 |
| IUPAC Name | 4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]sulfanyl]-3,5-difluoroaniline |
| SMILES | Nc1cc(F)c(Sc2ncc(C(F)(F)F)cc2Cl)c(F)c1 |
| InChI | InChI=1S/C12H6ClF5N2S/c13-7-1-5(12(16,17)18)4-20-11(7)21-10-8(14)2-6(19)3-9(10)15/h1-4H,19H2 |
| InChIKey | KPLKXHAAEOAKCE-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.70 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|