C15H9ClF3N3S — CID 1474303
3-chloro-2-(1-phenylimidazol-2-yl)sulfanyl-5-(trifluoromethyl)pyridine (PubChem CID 1474303) has the molecular formula C15H9ClF3N3S and a molecular weight of 355.77 g/mol. Its IUPAC name is 3-chloro-2-(1-phenylimidazol-2-yl)sulfanyl-5-(trifluoromethyl)pyridine.
| Compound Name | 3-chloro-2-(1-phenylimidazol-2-yl)sulfanyl-5-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 1474303 |
| Molecular Formula | C15H9ClF3N3S |
| Molecular Weight | 355.77 g/mol |
| Exact Mass | 355.02 |
| IUPAC Name | 3-chloro-2-(1-phenylimidazol-2-yl)sulfanyl-5-(trifluoromethyl)pyridine |
| SMILES | FC(F)(F)c1cnc(Sc2nccn2-c2ccccc2)c(Cl)c1 |
| InChI | InChI=1S/C15H9ClF3N3S/c16-12-8-10(15(17,18)19)9-21-13(12)23-14-20-6-7-22(14)11-4-2-1-3-5-11/h1-9H |
| InChIKey | ZCKAIIJLUVIMLF-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.77 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |