C16H10ClF3N2O2S — CID 46910672
2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]sulfanyl]-1-methylindole-3-carboxylic acid (PubChem CID 46910672) has the molecular formula C16H10ClF3N2O2S and a molecular weight of 386.78 g/mol. Its IUPAC name is 2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]sulfanyl]-1-methylindole-3-carboxylic acid.
| Compound Name | 2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]sulfanyl]-1-methylindole-3-carboxylic acid |
|---|---|
| PubChem CID | 46910672 |
| Molecular Formula | C16H10ClF3N2O2S |
| Molecular Weight | 386.78 g/mol |
| Exact Mass | 386.01 |
| IUPAC Name | 2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]sulfanyl]-1-methylindole-3-carboxylic acid |
| SMILES | Cn1c(Sc2ncc(C(F)(F)F)cc2Cl)c(C(=O)O)c2ccccc21 |
| InChI | InChI=1S/C16H10ClF3N2O2S/c1-22-11-5-3-2-4-9(11)12(15(23)24)14(22)25-13-10(17)6-8(7-21-13)16(18,19)20/h2-7H,1H3,(H,23,24) |
| InChIKey | NIXOWUNUPPPHED-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.78 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |