C10H9ClF3NO2S — CID 81231058
2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]sulfanyl]-2-methylpropanoic acid (PubChem CID 81231058) has the molecular formula C10H9ClF3NO2S and a molecular weight of 299.70 g/mol. Its IUPAC name is 2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]sulfanyl]-2-methylpropanoic acid.
| Compound Name | 2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]sulfanyl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 81231058 |
| Molecular Formula | C10H9ClF3NO2S |
| Molecular Weight | 299.70 g/mol |
| Exact Mass | 299.00 |
| IUPAC Name | 2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]sulfanyl]-2-methylpropanoic acid |
| SMILES | CC(C)(Sc1ncc(C(F)(F)F)cc1Cl)C(=O)O |
| InChI | InChI=1S/C10H9ClF3NO2S/c1-9(2,8(16)17)18-7-6(11)3-5(4-15-7)10(12,13)14/h3-4H,1-2H3,(H,16,17) |
| InChIKey | OIYPYHJZDZRZBI-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.70 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |