C13H16ClF3N2O2 — CID 115430013
2-[[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]methyl]-2-ethylbutanoic acid (PubChem CID 115430013) has the molecular formula C13H16ClF3N2O2 and a molecular weight of 324.73 g/mol. Its IUPAC name is 2-[[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]methyl]-2-ethylbutanoic acid.
| Compound Name | 2-[[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]methyl]-2-ethylbutanoic acid |
|---|---|
| PubChem CID | 115430013 |
| Molecular Formula | C13H16ClF3N2O2 |
| Molecular Weight | 324.73 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | 2-[[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]methyl]-2-ethylbutanoic acid |
| SMILES | CCC(CC)(CNc1ncc(C(F)(F)F)cc1Cl)C(=O)O |
| InChI | InChI=1S/C13H16ClF3N2O2/c1-3-12(4-2,11(20)21)7-19-10-9(14)5-8(6-18-10)13(15,16)17/h5-6H,3-4,7H2,1-2H3,(H,18,19)(H,20,21) |
| InChIKey | BVEIMJJAPVXULO-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.73 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |