C15H22ClF3N4O — CID 119641211
N-(2-amino-2-ethylbutyl)-3-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]propanamide (PubChem CID 119641211) has the molecular formula C15H22ClF3N4O and a molecular weight of 366.82 g/mol. Its IUPAC name is N-(2-amino-2-ethylbutyl)-3-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]propanamide.
| Compound Name | N-(2-amino-2-ethylbutyl)-3-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]propanamide |
|---|---|
| PubChem CID | 119641211 |
| Molecular Formula | C15H22ClF3N4O |
| Molecular Weight | 366.82 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | N-(2-amino-2-ethylbutyl)-3-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]propanamide |
| SMILES | CCC(N)(CC)CNC(=O)CCNc1ncc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C15H22ClF3N4O/c1-3-14(20,4-2)9-23-12(24)5-6-21-13-11(16)7-10(8-22-13)15(17,18)19/h7-8H,3-6,9,20H2,1-2H3,(H,21,22)(H,23,24) |
| InChIKey | ZZWZYENVMHISHU-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.82 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |