C11H14ClF3N4O — CID 119383283
N-(2-aminoethyl)-3-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]propanamide (PubChem CID 119383283) has the molecular formula C11H14ClF3N4O and a molecular weight of 310.71 g/mol. Its IUPAC name is N-(2-aminoethyl)-3-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]propanamide.
| Compound Name | N-(2-aminoethyl)-3-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]propanamide |
|---|---|
| PubChem CID | 119383283 |
| Molecular Formula | C11H14ClF3N4O |
| Molecular Weight | 310.71 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | N-(2-aminoethyl)-3-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]propanamide |
| SMILES | NCCNC(=O)CCNc1ncc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C11H14ClF3N4O/c12-8-5-7(11(13,14)15)6-19-10(8)18-3-1-9(20)17-4-2-16/h5-6H,1-4,16H2,(H,17,20)(H,18,19) |
| InChIKey | SXLOEGPGQQUGKQ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.71 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |