C17H17ClF3N3O2S — CID 26373754
N-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-4-(5-methylthiophen-2-yl)-4-oxobutanamide (PubChem CID 26373754) has the molecular formula C17H17ClF3N3O2S and a molecular weight of 419.86 g/mol. Its IUPAC name is N-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-4-(5-methylthiophen-2-yl)-4-oxobutanamide.
| Compound Name | N-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-4-(5-methylthiophen-2-yl)-4-oxobutanamide |
|---|---|
| PubChem CID | 26373754 |
| Molecular Formula | C17H17ClF3N3O2S |
| Molecular Weight | 419.86 g/mol |
| Exact Mass | 419.07 |
| IUPAC Name | N-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-4-(5-methylthiophen-2-yl)-4-oxobutanamide |
| SMILES | Cc1ccc(C(=O)CCC(=O)NCCNc2ncc(C(F)(F)F)cc2Cl)s1 |
| InChI | InChI=1S/C17H17ClF3N3O2S/c1-10-2-4-14(27-10)13(25)3-5-15(26)22-6-7-23-16-12(18)8-11(9-24-16)17(19,20)21/h2,4,8-9H,3,5-7H2,1H3,(H,22,26)(H,23,24) |
| InChIKey | BACGHEQPHDOMDJ-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.86 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|