C18H18F3NO2S — CID 31146992
4-(5-methylthiophen-2-yl)-4-oxo-N-[2-[4-(trifluoromethyl)phenyl]ethyl]butanamide (PubChem CID 31146992) has the molecular formula C18H18F3NO2S and a molecular weight of 369.41 g/mol. Its IUPAC name is 4-(5-methylthiophen-2-yl)-4-oxo-N-[2-[4-(trifluoromethyl)phenyl]ethyl]butanamide.
| Compound Name | 4-(5-methylthiophen-2-yl)-4-oxo-N-[2-[4-(trifluoromethyl)phenyl]ethyl]butanamide |
|---|---|
| PubChem CID | 31146992 |
| Molecular Formula | C18H18F3NO2S |
| Molecular Weight | 369.41 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | 4-(5-methylthiophen-2-yl)-4-oxo-N-[2-[4-(trifluoromethyl)phenyl]ethyl]butanamide |
| SMILES | Cc1ccc(C(=O)CCC(=O)NCCc2ccc(C(F)(F)F)cc2)s1 |
| InChI | InChI=1S/C18H18F3NO2S/c1-12-2-8-16(25-12)15(23)7-9-17(24)22-11-10-13-3-5-14(6-4-13)18(19,20)21/h2-6,8H,7,9-11H2,1H3,(H,22,24) |
| InChIKey | YYODNTBMBWYSHG-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.41 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |