C21H23ClN2O4S — CID 55631917
4-chloro-N-[2-[[7-(5-methylthiophen-2-yl)-4,7-dioxoheptanoyl]amino]ethyl]benzamide (PubChem CID 55631917) has the molecular formula C21H23ClN2O4S and a molecular weight of 434.95 g/mol. Its IUPAC name is 4-chloro-N-[2-[[7-(5-methylthiophen-2-yl)-4,7-dioxoheptanoyl]amino]ethyl]benzamide.
| Compound Name | 4-chloro-N-[2-[[7-(5-methylthiophen-2-yl)-4,7-dioxoheptanoyl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 55631917 |
| Molecular Formula | C21H23ClN2O4S |
| Molecular Weight | 434.95 g/mol |
| Exact Mass | 434.11 |
| IUPAC Name | 4-chloro-N-[2-[[7-(5-methylthiophen-2-yl)-4,7-dioxoheptanoyl]amino]ethyl]benzamide |
| SMILES | Cc1ccc(C(=O)CCC(=O)CCC(=O)NCCNC(=O)c2ccc(Cl)cc2)s1 |
| InChI | InChI=1S/C21H23ClN2O4S/c1-14-2-10-19(29-14)18(26)9-7-17(25)8-11-20(27)23-12-13-24-21(28)15-3-5-16(22)6-4-15/h2-6,10H,7-9,11-13H2,1H3,(H,23,27)(H,24,28) |
| InChIKey | KVLHXFOXCDFOIK-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.95 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|