C20H20Cl2N2O3 — CID 108540671
2,5-dichloro-N-[2-[[4-(4-methylphenyl)-4-oxobutanoyl]amino]ethyl]benzamide (PubChem CID 108540671) has the molecular formula C20H20Cl2N2O3 and a molecular weight of 407.30 g/mol. Its IUPAC name is 2,5-dichloro-N-[2-[[4-(4-methylphenyl)-4-oxobutanoyl]amino]ethyl]benzamide.
| Compound Name | 2,5-dichloro-N-[2-[[4-(4-methylphenyl)-4-oxobutanoyl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 108540671 |
| Molecular Formula | C20H20Cl2N2O3 |
| Molecular Weight | 407.30 g/mol |
| Exact Mass | 406.09 |
| IUPAC Name | 2,5-dichloro-N-[2-[[4-(4-methylphenyl)-4-oxobutanoyl]amino]ethyl]benzamide |
| SMILES | Cc1ccc(C(=O)CCC(=O)NCCNC(=O)c2cc(Cl)ccc2Cl)cc1 |
| InChI | InChI=1S/C20H20Cl2N2O3/c1-13-2-4-14(5-3-13)18(25)8-9-19(26)23-10-11-24-20(27)16-12-15(21)6-7-17(16)22/h2-7,12H,8-11H2,1H3,(H,23,26)(H,24,27) |
| InChIKey | XAXAOAQZMBXPKS-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.30 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|