C15H18Cl2N2O4 — CID 108573410
ethyl 4-[2-[(2,5-dichlorobenzoyl)amino]ethylamino]-4-oxobutanoate (PubChem CID 108573410) has the molecular formula C15H18Cl2N2O4 and a molecular weight of 361.23 g/mol. Its IUPAC name is ethyl 4-[2-[(2,5-dichlorobenzoyl)amino]ethylamino]-4-oxobutanoate.
| Compound Name | ethyl 4-[2-[(2,5-dichlorobenzoyl)amino]ethylamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 108573410 |
| Molecular Formula | C15H18Cl2N2O4 |
| Molecular Weight | 361.23 g/mol |
| Exact Mass | 360.06 |
| IUPAC Name | ethyl 4-[2-[(2,5-dichlorobenzoyl)amino]ethylamino]-4-oxobutanoate |
| SMILES | CCOC(=O)CCC(=O)NCCNC(=O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C15H18Cl2N2O4/c1-2-23-14(21)6-5-13(20)18-7-8-19-15(22)11-9-10(16)3-4-12(11)17/h3-4,9H,2,5-8H2,1H3,(H,18,20)(H,19,22) |
| InChIKey | YATUFZWRFXGEOY-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.23 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|