C15H19ClN2O4 — CID 91637595
ethyl 3-[3-[(2-chlorobenzoyl)amino]propanoylamino]propanoate (PubChem CID 91637595) has the molecular formula C15H19ClN2O4 and a molecular weight of 326.78 g/mol. Its IUPAC name is ethyl 3-[3-[(2-chlorobenzoyl)amino]propanoylamino]propanoate.
| Compound Name | ethyl 3-[3-[(2-chlorobenzoyl)amino]propanoylamino]propanoate |
|---|---|
| PubChem CID | 91637595 |
| Molecular Formula | C15H19ClN2O4 |
| Molecular Weight | 326.78 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | ethyl 3-[3-[(2-chlorobenzoyl)amino]propanoylamino]propanoate |
| SMILES | CCOC(=O)CCNC(=O)CCNC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C15H19ClN2O4/c1-2-22-14(20)8-10-17-13(19)7-9-18-15(21)11-5-3-4-6-12(11)16/h3-6H,2,7-10H2,1H3,(H,17,19)(H,18,21) |
| InChIKey | FTRBTXDLAPZKFM-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.78 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |