C19H19ClN2O4 — CID 7958134
ethyl 2-[3-[(2-chlorobenzoyl)amino]propanoylamino]benzoate (PubChem CID 7958134) has the molecular formula C19H19ClN2O4 and a molecular weight of 374.82 g/mol. Its IUPAC name is ethyl 2-[3-[(2-chlorobenzoyl)amino]propanoylamino]benzoate.
| Compound Name | ethyl 2-[3-[(2-chlorobenzoyl)amino]propanoylamino]benzoate |
|---|---|
| PubChem CID | 7958134 |
| Molecular Formula | C19H19ClN2O4 |
| Molecular Weight | 374.82 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | ethyl 2-[3-[(2-chlorobenzoyl)amino]propanoylamino]benzoate |
| SMILES | CCOC(=O)c1ccccc1NC(=O)CCNC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C19H19ClN2O4/c1-2-26-19(25)14-8-4-6-10-16(14)22-17(23)11-12-21-18(24)13-7-3-5-9-15(13)20/h3-10H,2,11-12H2,1H3,(H,21,24)(H,22,23) |
| InChIKey | MOZCPFPJQLEJMW-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.82 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |