C15H19FN2O4 — CID 108570798
ethyl 4-[2-[(2-fluorobenzoyl)amino]ethylamino]-4-oxobutanoate (PubChem CID 108570798) has the molecular formula C15H19FN2O4 and a molecular weight of 310.32 g/mol. Its IUPAC name is ethyl 4-[2-[(2-fluorobenzoyl)amino]ethylamino]-4-oxobutanoate.
| Compound Name | ethyl 4-[2-[(2-fluorobenzoyl)amino]ethylamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 108570798 |
| Molecular Formula | C15H19FN2O4 |
| Molecular Weight | 310.32 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | ethyl 4-[2-[(2-fluorobenzoyl)amino]ethylamino]-4-oxobutanoate |
| SMILES | CCOC(=O)CCC(=O)NCCNC(=O)c1ccccc1F |
| InChI | InChI=1S/C15H19FN2O4/c1-2-22-14(20)8-7-13(19)17-9-10-18-15(21)11-5-3-4-6-12(11)16/h3-6H,2,7-10H2,1H3,(H,17,19)(H,18,21) |
| InChIKey | XETDBKVUBITUMH-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.32 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|