C19H19FN2O5 — CID 108537531
ethyl [4-[2-[(2-fluorobenzoyl)amino]ethylcarbamoyl]phenyl] carbonate (PubChem CID 108537531) has the molecular formula C19H19FN2O5 and a molecular weight of 374.37 g/mol. Its IUPAC name is ethyl [4-[2-[(2-fluorobenzoyl)amino]ethylcarbamoyl]phenyl] carbonate.
| Compound Name | ethyl [4-[2-[(2-fluorobenzoyl)amino]ethylcarbamoyl]phenyl] carbonate |
|---|---|
| PubChem CID | 108537531 |
| Molecular Formula | C19H19FN2O5 |
| Molecular Weight | 374.37 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | ethyl [4-[2-[(2-fluorobenzoyl)amino]ethylcarbamoyl]phenyl] carbonate |
| SMILES | CCOC(=O)Oc1ccc(C(=O)NCCNC(=O)c2ccccc2F)cc1 |
| InChI | InChI=1S/C19H19FN2O5/c1-2-26-19(25)27-14-9-7-13(8-10-14)17(23)21-11-12-22-18(24)15-5-3-4-6-16(15)20/h3-10H,2,11-12H2,1H3,(H,21,23)(H,22,24) |
| InChIKey | ZIUPARISLHFFHW-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.37 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|