C21H23ClN2O6 — CID 108929802
[4-[2-[2-(4-chlorophenoxy)propanoylamino]ethylcarbamoyl]phenyl] ethyl carbonate (PubChem CID 108929802) has the molecular formula C21H23ClN2O6 and a molecular weight of 434.88 g/mol. Its IUPAC name is [4-[2-[2-(4-chlorophenoxy)propanoylamino]ethylcarbamoyl]phenyl] ethyl carbonate.
| Compound Name | [4-[2-[2-(4-chlorophenoxy)propanoylamino]ethylcarbamoyl]phenyl] ethyl carbonate |
|---|---|
| PubChem CID | 108929802 |
| Molecular Formula | C21H23ClN2O6 |
| Molecular Weight | 434.88 g/mol |
| Exact Mass | 434.12 |
| IUPAC Name | [4-[2-[2-(4-chlorophenoxy)propanoylamino]ethylcarbamoyl]phenyl] ethyl carbonate |
| SMILES | CCOC(=O)Oc1ccc(C(=O)NCCNC(=O)C(C)Oc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C21H23ClN2O6/c1-3-28-21(27)30-18-8-4-15(5-9-18)20(26)24-13-12-23-19(25)14(2)29-17-10-6-16(22)7-11-17/h4-11,14H,3,12-13H2,1-2H3,(H,23,25)(H,24,26) |
| InChIKey | ZXTCPHYOVNRGTQ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.88 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|