C26H25ClN2O6 — CID 108931608
[4-[[2-[2-(4-chlorophenoxy)propanoylamino]phenyl]methylcarbamoyl]phenyl] ethyl carbonate (PubChem CID 108931608) has the molecular formula C26H25ClN2O6 and a molecular weight of 496.95 g/mol. Its IUPAC name is [4-[[2-[2-(4-chlorophenoxy)propanoylamino]phenyl]methylcarbamoyl]phenyl] ethyl carbonate.
| Compound Name | [4-[[2-[2-(4-chlorophenoxy)propanoylamino]phenyl]methylcarbamoyl]phenyl] ethyl carbonate |
|---|---|
| PubChem CID | 108931608 |
| Molecular Formula | C26H25ClN2O6 |
| Molecular Weight | 496.95 g/mol |
| Exact Mass | 496.14 |
| IUPAC Name | [4-[[2-[2-(4-chlorophenoxy)propanoylamino]phenyl]methylcarbamoyl]phenyl] ethyl carbonate |
| SMILES | CCOC(=O)Oc1ccc(C(=O)NCc2ccccc2NC(=O)C(C)Oc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C26H25ClN2O6/c1-3-33-26(32)35-22-12-8-18(9-13-22)25(31)28-16-19-6-4-5-7-23(19)29-24(30)17(2)34-21-14-10-20(27)11-15-21/h4-15,17H,3,16H2,1-2H3,(H,28,31)(H,29,30) |
| InChIKey | QYAMTEUAROVUPL-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.95 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|