C24H20Cl2N2O5 — CID 108931501
[4-[[2-[[(3,4-dichlorobenzoyl)amino]methyl]phenyl]carbamoyl]phenyl] ethyl carbonate (PubChem CID 108931501) has the molecular formula C24H20Cl2N2O5 and a molecular weight of 487.34 g/mol. Its IUPAC name is [4-[[2-[[(3,4-dichlorobenzoyl)amino]methyl]phenyl]carbamoyl]phenyl] ethyl carbonate.
| Compound Name | [4-[[2-[[(3,4-dichlorobenzoyl)amino]methyl]phenyl]carbamoyl]phenyl] ethyl carbonate |
|---|---|
| PubChem CID | 108931501 |
| Molecular Formula | C24H20Cl2N2O5 |
| Molecular Weight | 487.34 g/mol |
| Exact Mass | 486.07 |
| IUPAC Name | [4-[[2-[[(3,4-dichlorobenzoyl)amino]methyl]phenyl]carbamoyl]phenyl] ethyl carbonate |
| SMILES | CCOC(=O)Oc1ccc(C(=O)Nc2ccccc2CNC(=O)c2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C24H20Cl2N2O5/c1-2-32-24(31)33-18-10-7-15(8-11-18)23(30)28-21-6-4-3-5-17(21)14-27-22(29)16-9-12-19(25)20(26)13-16/h3-13H,2,14H2,1H3,(H,27,29)(H,28,30) |
| InChIKey | YDCLCTGHKPUXHK-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.34 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|