C24H20ClFN2O5 — CID 108931734
[4-[[2-[(2-chloro-6-fluorobenzoyl)amino]phenyl]methylcarbamoyl]phenyl] ethyl carbonate (PubChem CID 108931734) has the molecular formula C24H20ClFN2O5 and a molecular weight of 470.88 g/mol. Its IUPAC name is [4-[[2-[(2-chloro-6-fluorobenzoyl)amino]phenyl]methylcarbamoyl]phenyl] ethyl carbonate.
| Compound Name | [4-[[2-[(2-chloro-6-fluorobenzoyl)amino]phenyl]methylcarbamoyl]phenyl] ethyl carbonate |
|---|---|
| PubChem CID | 108931734 |
| Molecular Formula | C24H20ClFN2O5 |
| Molecular Weight | 470.88 g/mol |
| Exact Mass | 470.10 |
| IUPAC Name | [4-[[2-[(2-chloro-6-fluorobenzoyl)amino]phenyl]methylcarbamoyl]phenyl] ethyl carbonate |
| SMILES | CCOC(=O)Oc1ccc(C(=O)NCc2ccccc2NC(=O)c2c(F)cccc2Cl)cc1 |
| InChI | InChI=1S/C24H20ClFN2O5/c1-2-32-24(31)33-17-12-10-15(11-13-17)22(29)27-14-16-6-3-4-9-20(16)28-23(30)21-18(25)7-5-8-19(21)26/h3-13H,2,14H2,1H3,(H,27,29)(H,28,30) |
| InChIKey | OFSORUPVQXCWFI-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.88 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|