C23H18ClFN2O5 — CID 108931048
[4-[[2-[(2-chloro-6-fluorobenzoyl)amino]phenyl]carbamoyl]phenyl] ethyl carbonate (PubChem CID 108931048) has the molecular formula C23H18ClFN2O5 and a molecular weight of 456.86 g/mol. Its IUPAC name is [4-[[2-[(2-chloro-6-fluorobenzoyl)amino]phenyl]carbamoyl]phenyl] ethyl carbonate.
| Compound Name | [4-[[2-[(2-chloro-6-fluorobenzoyl)amino]phenyl]carbamoyl]phenyl] ethyl carbonate |
|---|---|
| PubChem CID | 108931048 |
| Molecular Formula | C23H18ClFN2O5 |
| Molecular Weight | 456.86 g/mol |
| Exact Mass | 456.09 |
| IUPAC Name | [4-[[2-[(2-chloro-6-fluorobenzoyl)amino]phenyl]carbamoyl]phenyl] ethyl carbonate |
| SMILES | CCOC(=O)Oc1ccc(C(=O)Nc2ccccc2NC(=O)c2c(F)cccc2Cl)cc1 |
| InChI | InChI=1S/C23H18ClFN2O5/c1-2-31-23(30)32-15-12-10-14(11-13-15)21(28)26-18-8-3-4-9-19(18)27-22(29)20-16(24)6-5-7-17(20)25/h3-13H,2H2,1H3,(H,26,28)(H,27,29) |
| InChIKey | RFKQEWRRPCEXPE-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.86 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|