C23H18Cl2N2O5 — CID 108931003
[4-[[2-[(2,5-dichlorobenzoyl)amino]phenyl]carbamoyl]phenyl] ethyl carbonate (PubChem CID 108931003) has the molecular formula C23H18Cl2N2O5 and a molecular weight of 473.31 g/mol. Its IUPAC name is [4-[[2-[(2,5-dichlorobenzoyl)amino]phenyl]carbamoyl]phenyl] ethyl carbonate.
| Compound Name | [4-[[2-[(2,5-dichlorobenzoyl)amino]phenyl]carbamoyl]phenyl] ethyl carbonate |
|---|---|
| PubChem CID | 108931003 |
| Molecular Formula | C23H18Cl2N2O5 |
| Molecular Weight | 473.31 g/mol |
| Exact Mass | 472.06 |
| IUPAC Name | [4-[[2-[(2,5-dichlorobenzoyl)amino]phenyl]carbamoyl]phenyl] ethyl carbonate |
| SMILES | CCOC(=O)Oc1ccc(C(=O)Nc2ccccc2NC(=O)c2cc(Cl)ccc2Cl)cc1 |
| InChI | InChI=1S/C23H18Cl2N2O5/c1-2-31-23(30)32-16-10-7-14(8-11-16)21(28)26-19-5-3-4-6-20(19)27-22(29)17-13-15(24)9-12-18(17)25/h3-13H,2H2,1H3,(H,26,28)(H,27,29) |
| InChIKey | LLTQPJYUVZFLGD-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.31 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|