C24H19F3N2O5 — CID 108931697
ethyl [4-[[2-[[(2,3,4-trifluorobenzoyl)amino]methyl]phenyl]carbamoyl]phenyl] carbonate (PubChem CID 108931697) has the molecular formula C24H19F3N2O5 and a molecular weight of 472.42 g/mol. Its IUPAC name is ethyl [4-[[2-[[(2,3,4-trifluorobenzoyl)amino]methyl]phenyl]carbamoyl]phenyl] carbonate.
| Compound Name | ethyl [4-[[2-[[(2,3,4-trifluorobenzoyl)amino]methyl]phenyl]carbamoyl]phenyl] carbonate |
|---|---|
| PubChem CID | 108931697 |
| Molecular Formula | C24H19F3N2O5 |
| Molecular Weight | 472.42 g/mol |
| Exact Mass | 472.12 |
| IUPAC Name | ethyl [4-[[2-[[(2,3,4-trifluorobenzoyl)amino]methyl]phenyl]carbamoyl]phenyl] carbonate |
| SMILES | CCOC(=O)Oc1ccc(C(=O)Nc2ccccc2CNC(=O)c2ccc(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C24H19F3N2O5/c1-2-33-24(32)34-16-9-7-14(8-10-16)22(30)29-19-6-4-3-5-15(19)13-28-23(31)17-11-12-18(25)21(27)20(17)26/h3-12H,2,13H2,1H3,(H,28,31)(H,29,30) |
| InChIKey | PPERMWZKWIIISP-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.42 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|