C25H23FN2O5 — CID 108931747
ethyl [4-[[2-[[[2-(2-fluorophenyl)acetyl]amino]methyl]phenyl]carbamoyl]phenyl] carbonate (PubChem CID 108931747) has the molecular formula C25H23FN2O5 and a molecular weight of 450.47 g/mol. Its IUPAC name is ethyl [4-[[2-[[[2-(2-fluorophenyl)acetyl]amino]methyl]phenyl]carbamoyl]phenyl] carbonate.
| Compound Name | ethyl [4-[[2-[[[2-(2-fluorophenyl)acetyl]amino]methyl]phenyl]carbamoyl]phenyl] carbonate |
|---|---|
| PubChem CID | 108931747 |
| Molecular Formula | C25H23FN2O5 |
| Molecular Weight | 450.47 g/mol |
| Exact Mass | 450.16 |
| IUPAC Name | ethyl [4-[[2-[[[2-(2-fluorophenyl)acetyl]amino]methyl]phenyl]carbamoyl]phenyl] carbonate |
| SMILES | CCOC(=O)Oc1ccc(C(=O)Nc2ccccc2CNC(=O)Cc2ccccc2F)cc1 |
| InChI | InChI=1S/C25H23FN2O5/c1-2-32-25(31)33-20-13-11-17(12-14-20)24(30)28-22-10-6-4-8-19(22)16-27-23(29)15-18-7-3-5-9-21(18)26/h3-14H,2,15-16H2,1H3,(H,27,29)(H,28,30) |
| InChIKey | FQBVCGKYDHKCHC-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.47 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|