C21H22N2O6 — CID 108931042
ethyl [4-[[2-(4-oxopentanoylamino)phenyl]carbamoyl]phenyl] carbonate (PubChem CID 108931042) has the molecular formula C21H22N2O6 and a molecular weight of 398.42 g/mol. Its IUPAC name is ethyl [4-[[2-(4-oxopentanoylamino)phenyl]carbamoyl]phenyl] carbonate.
| Compound Name | ethyl [4-[[2-(4-oxopentanoylamino)phenyl]carbamoyl]phenyl] carbonate |
|---|---|
| PubChem CID | 108931042 |
| Molecular Formula | C21H22N2O6 |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | ethyl [4-[[2-(4-oxopentanoylamino)phenyl]carbamoyl]phenyl] carbonate |
| SMILES | CCOC(=O)Oc1ccc(C(=O)Nc2ccccc2NC(=O)CCC(C)=O)cc1 |
| InChI | InChI=1S/C21H22N2O6/c1-3-28-21(27)29-16-11-9-15(10-12-16)20(26)23-18-7-5-4-6-17(18)22-19(25)13-8-14(2)24/h4-7,9-12H,3,8,13H2,1-2H3,(H,22,25)(H,23,26) |
| InChIKey | BMPCBWHSYCSQMT-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|