C22H24N2O6 — CID 108932100
ethyl [4-[[3-[(4-oxopentanoylamino)methyl]phenyl]carbamoyl]phenyl] carbonate (PubChem CID 108932100) has the molecular formula C22H24N2O6 and a molecular weight of 412.44 g/mol. Its IUPAC name is ethyl [4-[[3-[(4-oxopentanoylamino)methyl]phenyl]carbamoyl]phenyl] carbonate.
| Compound Name | ethyl [4-[[3-[(4-oxopentanoylamino)methyl]phenyl]carbamoyl]phenyl] carbonate |
|---|---|
| PubChem CID | 108932100 |
| Molecular Formula | C22H24N2O6 |
| Molecular Weight | 412.44 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | ethyl [4-[[3-[(4-oxopentanoylamino)methyl]phenyl]carbamoyl]phenyl] carbonate |
| SMILES | CCOC(=O)Oc1ccc(C(=O)Nc2cccc(CNC(=O)CCC(C)=O)c2)cc1 |
| InChI | InChI=1S/C22H24N2O6/c1-3-29-22(28)30-19-10-8-17(9-11-19)21(27)24-18-6-4-5-16(13-18)14-23-20(26)12-7-15(2)25/h4-6,8-11,13H,3,7,12,14H2,1-2H3,(H,23,26)(H,24,27) |
| InChIKey | DBMHPQUESXUDPL-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.44 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|