C28H30N2O6 — CID 108931994
ethyl [4-[[3-[[4-(4-methylphenoxy)butanoylamino]methyl]phenyl]carbamoyl]phenyl] carbonate (PubChem CID 108931994) has the molecular formula C28H30N2O6 and a molecular weight of 490.56 g/mol. Its IUPAC name is ethyl [4-[[3-[[4-(4-methylphenoxy)butanoylamino]methyl]phenyl]carbamoyl]phenyl] carbonate.
| Compound Name | ethyl [4-[[3-[[4-(4-methylphenoxy)butanoylamino]methyl]phenyl]carbamoyl]phenyl] carbonate |
|---|---|
| PubChem CID | 108931994 |
| Molecular Formula | C28H30N2O6 |
| Molecular Weight | 490.56 g/mol |
| Exact Mass | 490.21 |
| IUPAC Name | ethyl [4-[[3-[[4-(4-methylphenoxy)butanoylamino]methyl]phenyl]carbamoyl]phenyl] carbonate |
| SMILES | CCOC(=O)Oc1ccc(C(=O)Nc2cccc(CNC(=O)CCCOc3ccc(C)cc3)c2)cc1 |
| InChI | InChI=1S/C28H30N2O6/c1-3-34-28(33)36-25-15-11-22(12-16-25)27(32)30-23-7-4-6-21(18-23)19-29-26(31)8-5-17-35-24-13-9-20(2)10-14-24/h4,6-7,9-16,18H,3,5,8,17,19H2,1-2H3,(H,29,31)(H,30,32) |
| InChIKey | IHMKOTJMCGZBAG-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.56 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|