C28H28N2O6 — CID 108931955
ethyl [4-[[3-[[4-(4-methylphenyl)-4-oxobutanoyl]amino]phenyl]methylcarbamoyl]phenyl] carbonate (PubChem CID 108931955) has the molecular formula C28H28N2O6 and a molecular weight of 488.54 g/mol. Its IUPAC name is ethyl [4-[[3-[[4-(4-methylphenyl)-4-oxobutanoyl]amino]phenyl]methylcarbamoyl]phenyl] carbonate.
| Compound Name | ethyl [4-[[3-[[4-(4-methylphenyl)-4-oxobutanoyl]amino]phenyl]methylcarbamoyl]phenyl] carbonate |
|---|---|
| PubChem CID | 108931955 |
| Molecular Formula | C28H28N2O6 |
| Molecular Weight | 488.54 g/mol |
| Exact Mass | 488.19 |
| IUPAC Name | ethyl [4-[[3-[[4-(4-methylphenyl)-4-oxobutanoyl]amino]phenyl]methylcarbamoyl]phenyl] carbonate |
| SMILES | CCOC(=O)Oc1ccc(C(=O)NCc2cccc(NC(=O)CCC(=O)c3ccc(C)cc3)c2)cc1 |
| InChI | InChI=1S/C28H28N2O6/c1-3-35-28(34)36-24-13-11-22(12-14-24)27(33)29-18-20-5-4-6-23(17-20)30-26(32)16-15-25(31)21-9-7-19(2)8-10-21/h4-14,17H,3,15-16,18H2,1-2H3,(H,29,33)(H,30,32) |
| InChIKey | MMPAKLZZQXBYHJ-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.54 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|