C19H17F3N2O5 — CID 108931872
ethyl [4-[[3-[[(2,2,2-trifluoroacetyl)amino]methyl]phenyl]carbamoyl]phenyl] carbonate (PubChem CID 108931872) has the molecular formula C19H17F3N2O5 and a molecular weight of 410.35 g/mol. Its IUPAC name is ethyl [4-[[3-[[(2,2,2-trifluoroacetyl)amino]methyl]phenyl]carbamoyl]phenyl] carbonate.
| Compound Name | ethyl [4-[[3-[[(2,2,2-trifluoroacetyl)amino]methyl]phenyl]carbamoyl]phenyl] carbonate |
|---|---|
| PubChem CID | 108931872 |
| Molecular Formula | C19H17F3N2O5 |
| Molecular Weight | 410.35 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | ethyl [4-[[3-[[(2,2,2-trifluoroacetyl)amino]methyl]phenyl]carbamoyl]phenyl] carbonate |
| SMILES | CCOC(=O)Oc1ccc(C(=O)Nc2cccc(CNC(=O)C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C19H17F3N2O5/c1-2-28-18(27)29-15-8-6-13(7-9-15)16(25)24-14-5-3-4-12(10-14)11-23-17(26)19(20,21)22/h3-10H,2,11H2,1H3,(H,23,26)(H,24,25) |
| InChIKey | YAMHUPGFDSZTRI-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.35 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|