C19H18Cl2N2O5 — CID 108537528
[4-[2-[(3,4-dichlorobenzoyl)amino]ethylcarbamoyl]phenyl] ethyl carbonate (PubChem CID 108537528) has the molecular formula C19H18Cl2N2O5 and a molecular weight of 425.27 g/mol. Its IUPAC name is [4-[2-[(3,4-dichlorobenzoyl)amino]ethylcarbamoyl]phenyl] ethyl carbonate.
| Compound Name | [4-[2-[(3,4-dichlorobenzoyl)amino]ethylcarbamoyl]phenyl] ethyl carbonate |
|---|---|
| PubChem CID | 108537528 |
| Molecular Formula | C19H18Cl2N2O5 |
| Molecular Weight | 425.27 g/mol |
| Exact Mass | 424.06 |
| IUPAC Name | [4-[2-[(3,4-dichlorobenzoyl)amino]ethylcarbamoyl]phenyl] ethyl carbonate |
| SMILES | CCOC(=O)Oc1ccc(C(=O)NCCNC(=O)c2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C19H18Cl2N2O5/c1-2-27-19(26)28-14-6-3-12(4-7-14)17(24)22-9-10-23-18(25)13-5-8-15(20)16(21)11-13/h3-8,11H,2,9-10H2,1H3,(H,22,24)(H,23,25) |
| InChIKey | BGPWWFLGPOJPPV-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.27 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|