C17H18N4O5 — CID 108537576
ethyl [4-[2-(pyrazine-2-carbonylamino)ethylcarbamoyl]phenyl] carbonate (PubChem CID 108537576) has the molecular formula C17H18N4O5 and a molecular weight of 358.35 g/mol. Its IUPAC name is ethyl [4-[2-(pyrazine-2-carbonylamino)ethylcarbamoyl]phenyl] carbonate.
| Compound Name | ethyl [4-[2-(pyrazine-2-carbonylamino)ethylcarbamoyl]phenyl] carbonate |
|---|---|
| PubChem CID | 108537576 |
| Molecular Formula | C17H18N4O5 |
| Molecular Weight | 358.35 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | ethyl [4-[2-(pyrazine-2-carbonylamino)ethylcarbamoyl]phenyl] carbonate |
| SMILES | CCOC(=O)Oc1ccc(C(=O)NCCNC(=O)c2cnccn2)cc1 |
| InChI | InChI=1S/C17H18N4O5/c1-2-25-17(24)26-13-5-3-12(4-6-13)15(22)20-9-10-21-16(23)14-11-18-7-8-19-14/h3-8,11H,2,9-10H2,1H3,(H,20,22)(H,21,23) |
| InChIKey | LNTPXIPAOKAIHE-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 119.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.35 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|