C16H20N2O5 — CID 108537565
[4-[2-(cyclopropanecarbonylamino)ethylcarbamoyl]phenyl] ethyl carbonate (PubChem CID 108537565) has the molecular formula C16H20N2O5 and a molecular weight of 320.35 g/mol. Its IUPAC name is [4-[2-(cyclopropanecarbonylamino)ethylcarbamoyl]phenyl] ethyl carbonate.
| Compound Name | [4-[2-(cyclopropanecarbonylamino)ethylcarbamoyl]phenyl] ethyl carbonate |
|---|---|
| PubChem CID | 108537565 |
| Molecular Formula | C16H20N2O5 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | [4-[2-(cyclopropanecarbonylamino)ethylcarbamoyl]phenyl] ethyl carbonate |
| SMILES | CCOC(=O)Oc1ccc(C(=O)NCCNC(=O)C2CC2)cc1 |
| InChI | InChI=1S/C16H20N2O5/c1-2-22-16(21)23-13-7-5-12(6-8-13)15(20)18-10-9-17-14(19)11-3-4-11/h5-8,11H,2-4,9-10H2,1H3,(H,17,19)(H,18,20) |
| InChIKey | KUZJQBJAAXVTIA-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|