C19H19BrN2O5 — CID 108537544
[4-[2-[(3-bromobenzoyl)amino]ethylcarbamoyl]phenyl] ethyl carbonate (PubChem CID 108537544) has the molecular formula C19H19BrN2O5 and a molecular weight of 435.27 g/mol. Its IUPAC name is [4-[2-[(3-bromobenzoyl)amino]ethylcarbamoyl]phenyl] ethyl carbonate.
| Compound Name | [4-[2-[(3-bromobenzoyl)amino]ethylcarbamoyl]phenyl] ethyl carbonate |
|---|---|
| PubChem CID | 108537544 |
| Molecular Formula | C19H19BrN2O5 |
| Molecular Weight | 435.27 g/mol |
| Exact Mass | 434.05 |
| IUPAC Name | [4-[2-[(3-bromobenzoyl)amino]ethylcarbamoyl]phenyl] ethyl carbonate |
| SMILES | CCOC(=O)Oc1ccc(C(=O)NCCNC(=O)c2cccc(Br)c2)cc1 |
| InChI | InChI=1S/C19H19BrN2O5/c1-2-26-19(25)27-16-8-6-13(7-9-16)17(23)21-10-11-22-18(24)14-4-3-5-15(20)12-14/h3-9,12H,2,10-11H2,1H3,(H,21,23)(H,22,24) |
| InChIKey | CIEODKWNRZLMBJ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.27 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|