C24H24BrN3O7 — CID 108929824
[4-[2-[4-(5-bromo-1,3-dioxoisoindol-2-yl)butanoylamino]ethylcarbamoyl]phenyl] ethyl carbonate (PubChem CID 108929824) has the molecular formula C24H24BrN3O7 and a molecular weight of 546.37 g/mol. Its IUPAC name is [4-[2-[4-(5-bromo-1,3-dioxoisoindol-2-yl)butanoylamino]ethylcarbamoyl]phenyl] ethyl carbonate.
| Compound Name | [4-[2-[4-(5-bromo-1,3-dioxoisoindol-2-yl)butanoylamino]ethylcarbamoyl]phenyl] ethyl carbonate |
|---|---|
| PubChem CID | 108929824 |
| Molecular Formula | C24H24BrN3O7 |
| Molecular Weight | 546.37 g/mol |
| Exact Mass | 545.08 |
| IUPAC Name | [4-[2-[4-(5-bromo-1,3-dioxoisoindol-2-yl)butanoylamino]ethylcarbamoyl]phenyl] ethyl carbonate |
| SMILES | CCOC(=O)Oc1ccc(C(=O)NCCNC(=O)CCCN2C(=O)c3ccc(Br)cc3C2=O)cc1 |
| InChI | InChI=1S/C24H24BrN3O7/c1-2-34-24(33)35-17-8-5-15(6-9-17)21(30)27-12-11-26-20(29)4-3-13-28-22(31)18-10-7-16(25)14-19(18)23(28)32/h5-10,14H,2-4,11-13H2,1H3,(H,26,29)(H,27,30) |
| InChIKey | BBKRNTBLJIREQK-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.37 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|